Three series of heterometallic NiII-LnIII Schiff base complexes: synthesis, crystal structures and magnetic characterization.

Abstract

Three series of NiII-LnIII complexes were synthesized with the general formulae [(μ3-CO3)2{Ni(HL)(CH3-CH2OH)Ln(CH3COO)}2]·2CH3CH2OH (1-6) (Ln = Tb (1), Dy (2), Ho (3), Er (4), Tm (5), Yb (6); H3L = N,N'-bis(3-methoxysalicylidene)-1,3-diamino-2-prop-anol), [Ni(HL)Ln(dbm)3]·CH3OH2·2CH2Cl2 (7-10) (Ln = Tb (7), Eu (8), Gd (9), Ho (10); Hdbm = 1,3-diphenyl-1,3… (More)
DOI: 10.1039/c7dt02351k

Topics

Cite this paper

@article{Jiang2017ThreeSO, title={Three series of heterometallic NiII-LnIII Schiff base complexes: synthesis, crystal structures and magnetic characterization.}, author={Lin Jiang and Yue Liu and Xin Liu and Jinlei Tian and Shiping Yan}, journal={Dalton transactions}, year={2017}, volume={46 37}, pages={12558-12573} }